C5H4ClNOS — CID 22498777
2-chloro-1-(1,3-thiazol-2-yl)ethanone (PubChem CID 22498777) has the molecular formula C5H4ClNOS and a molecular weight of 161.61 g/mol. Its IUPAC name is 2-chloro-1-(1,3-thiazol-2-yl)ethanone.
| Compound Name | 2-chloro-1-(1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 22498777 |
| Molecular Formula | C5H4ClNOS |
| Molecular Weight | 161.61 g/mol |
| Exact Mass | 160.97 |
| IUPAC Name | 2-chloro-1-(1,3-thiazol-2-yl)ethanone |
| SMILES | O=C(CCl)c1nccs1 |
| InChI | InChI=1S/C5H4ClNOS/c6-3-4(8)5-7-1-2-9-5/h1-2H,3H2 |
| InChIKey | NCSQLJMVLJILDV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.61 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|