C7H10N2O2S — CID 66568954
2-(2-hydroxyethylamino)-1-(1,3-thiazol-2-yl)ethanone (PubChem CID 66568954) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)-1-(1,3-thiazol-2-yl)ethanone.
| Compound Name | 2-(2-hydroxyethylamino)-1-(1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 66568954 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2-(2-hydroxyethylamino)-1-(1,3-thiazol-2-yl)ethanone |
| SMILES | O=C(CNCCO)c1nccs1 |
| InChI | InChI=1S/C7H10N2O2S/c10-3-1-8-5-6(11)7-9-2-4-12-7/h2,4,8,10H,1,3,5H2 |
| InChIKey | VFNWNCOOMQTPIG-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|