About 2-[[(3R)-piperidin-3-yl]amino]-1-(1,3-thiazol-2-yl)ethanone;hydrochloride
2-[[(3R)-piperidin-3-yl]amino]-1-(1,3-thiazol-2-yl)ethanone;hydrochloride (PubChem CID 71644976) has the molecular formula C10H16ClN3OS
and a molecular weight of 261.78 g/mol. Its IUPAC name is 2-[[(3R)-piperidin-3-yl]amino]-1-(1,3-thiazol-2-yl)ethanone;hydrochloride.
Molecular Properties
| Compound Name | 2-[[(3R)-piperidin-3-yl]amino]-1-(1,3-thiazol-2-yl)ethanone;hydrochloride |
| PubChem CID | 71644976 |
| Molecular Formula | C10H16ClN3OS |
| Molecular Weight | 261.78 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-[[(3R)-piperidin-3-yl]amino]-1-(1,3-thiazol-2-yl)ethanone;hydrochloride |
| SMILES | Cl.O=C(CN[C@@H]1CCCNC1)c1nccs1 |
| InChI | InChI=1S/C10H15N3OS.ClH/c14-9(10-12-4-5-15-10)7-13-8-2-1-3-11-6-8;/h4-5,8,11,13H,1-3,6-7H2;1H/t8-;/m1./s1 |
| InChIKey | ZMQUKCAUBOJMFX-DDWIOCJRSA-N |
| XLogP | 1.09 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.78 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(3R)-piperidin-3-yl]amino]-1-(1,3-thiazol-2-yl)ethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3R)-piperidin-3-yl]amino]-1-(1,3-thiazol-2-yl)ethanone;hydrochloride?
The IUPAC name of 2-[[(3R)-piperidin-3-yl]amino]-1-(1,3-thiazol-2-yl)ethanone;hydrochloride (CID 71644976) is 2-[[(3R)-piperidin-3-yl]amino]-1-(1,3-thiazol-2-yl)ethanone;hydrochloride.
What is the SMILES notation for 2-[[(3R)-piperidin-3-yl]amino]-1-(1,3-thiazol-2-yl)ethanone;hydrochloride?
The canonical SMILES for 2-[[(3R)-piperidin-3-yl]amino]-1-(1,3-thiazol-2-yl)ethanone;hydrochloride is Cl.O=C(CN[C@@H]1CCCNC1)c1nccs1.
What is the InChIKey of 2-[[(3R)-piperidin-3-yl]amino]-1-(1,3-thiazol-2-yl)ethanone;hydrochloride?
The InChIKey is ZMQUKCAUBOJMFX-DDWIOCJRSA-N. The full InChI is InChI=1S/C10H15N3OS.ClH/c14-9(10-12-4-5-15-10)7-13-8-2-1-3-11-6-8;/h4-5,8,11,13H,1-3,6-7H2;1H/t8-;/m1./s1.
What are the key properties of 2-[[(3R)-piperidin-3-yl]amino]-1-(1,3-thiazol-2-yl)ethanone;hydrochloride?
2-[[(3R)-piperidin-3-yl]amino]-1-(1,3-thiazol-2-yl)ethanone;hydrochloride has a molecular weight of 261.78 g/mol, XLogP of 1.09, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3R)-piperidin-3-yl]amino]-1-(1,3-thiazol-2-yl)ethanone;hydrochloride is sourced from PubChem (CID 71644976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).