C11H16N2O2S — CID 71645242
2-(piperidin-3-ylmethoxy)-1-(1,3-thiazol-2-yl)ethanone (PubChem CID 71645242) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 2-(piperidin-3-ylmethoxy)-1-(1,3-thiazol-2-yl)ethanone.
| Compound Name | 2-(piperidin-3-ylmethoxy)-1-(1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 71645242 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-(piperidin-3-ylmethoxy)-1-(1,3-thiazol-2-yl)ethanone |
| SMILES | O=C(COCC1CCCNC1)c1nccs1 |
| InChI | InChI=1S/C11H16N2O2S/c14-10(11-13-4-5-16-11)8-15-7-9-2-1-3-12-6-9/h4-5,9,12H,1-3,6-8H2 |
| InChIKey | LXCYWKCIFIVPBI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |