C13H20ClNO2S — CID 71645283
2-(2-piperidin-3-ylethoxy)-1-thiophen-2-ylethanone;hydrochloride (PubChem CID 71645283) has the molecular formula C13H20ClNO2S and a molecular weight of 289.83 g/mol. Its IUPAC name is 2-(2-piperidin-3-ylethoxy)-1-thiophen-2-ylethanone;hydrochloride.
| Compound Name | 2-(2-piperidin-3-ylethoxy)-1-thiophen-2-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 71645283 |
| Molecular Formula | C13H20ClNO2S |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-(2-piperidin-3-ylethoxy)-1-thiophen-2-ylethanone;hydrochloride |
| SMILES | Cl.O=C(COCCC1CCCNC1)c1cccs1 |
| InChI | InChI=1S/C13H19NO2S.ClH/c15-12(13-4-2-8-17-13)10-16-7-5-11-3-1-6-14-9-11;/h2,4,8,11,14H,1,3,5-7,9-10H2;1H |
| InChIKey | ZHQUOWAHTIJMBK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|