C15H23ClN2O2 — CID 71645321
2-(3-piperidin-3-ylpropoxy)-1-pyridin-2-ylethanone;hydrochloride (PubChem CID 71645321) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is 2-(3-piperidin-3-ylpropoxy)-1-pyridin-2-ylethanone;hydrochloride.
| Compound Name | 2-(3-piperidin-3-ylpropoxy)-1-pyridin-2-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 71645321 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-(3-piperidin-3-ylpropoxy)-1-pyridin-2-ylethanone;hydrochloride |
| SMILES | Cl.O=C(COCCCC1CCCNC1)c1ccccn1 |
| InChI | InChI=1S/C15H22N2O2.ClH/c18-15(14-7-1-2-9-17-14)12-19-10-4-6-13-5-3-8-16-11-13;/h1-2,7,9,13,16H,3-6,8,10-12H2;1H |
| InChIKey | XWZGMXCVVIASAR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|