C15H23N3O2S — CID 119557038
N-methyl-N-[2-oxo-2-(2-piperidin-3-ylethylamino)ethyl]thiophene-2-carboxamide (PubChem CID 119557038) has the molecular formula C15H23N3O2S and a molecular weight of 309.43 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-(2-piperidin-3-ylethylamino)ethyl]thiophene-2-carboxamide.
| Compound Name | N-methyl-N-[2-oxo-2-(2-piperidin-3-ylethylamino)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 119557038 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-methyl-N-[2-oxo-2-(2-piperidin-3-ylethylamino)ethyl]thiophene-2-carboxamide |
| SMILES | CN(CC(=O)NCCC1CCCNC1)C(=O)c1cccs1 |
| InChI | InChI=1S/C15H23N3O2S/c1-18(15(20)13-5-3-9-21-13)11-14(19)17-8-6-12-4-2-7-16-10-12/h3,5,9,12,16H,2,4,6-8,10-11H2,1H3,(H,17,19) |
| InChIKey | SXIVXDGTDHAVID-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |