C13H20N2OS2 — CID 119555349
3-methylsulfanyl-N-(2-piperidin-3-ylethyl)thiophene-2-carboxamide (PubChem CID 119555349) has the molecular formula C13H20N2OS2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 3-methylsulfanyl-N-(2-piperidin-3-ylethyl)thiophene-2-carboxamide.
| Compound Name | 3-methylsulfanyl-N-(2-piperidin-3-ylethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 119555349 |
| Molecular Formula | C13H20N2OS2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 3-methylsulfanyl-N-(2-piperidin-3-ylethyl)thiophene-2-carboxamide |
| SMILES | CSc1ccsc1C(=O)NCCC1CCCNC1 |
| InChI | InChI=1S/C13H20N2OS2/c1-17-11-5-8-18-12(11)13(16)15-7-4-10-3-2-6-14-9-10/h5,8,10,14H,2-4,6-7,9H2,1H3,(H,15,16) |
| InChIKey | RUPCTALPZLUBGE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |