C15H22ClFN2O — CID 119556963
3-fluoro-4-methyl-N-(2-piperidin-3-ylethyl)benzamide;hydrochloride (PubChem CID 119556963) has the molecular formula C15H22ClFN2O and a molecular weight of 300.81 g/mol. Its IUPAC name is 3-fluoro-4-methyl-N-(2-piperidin-3-ylethyl)benzamide;hydrochloride.
| Compound Name | 3-fluoro-4-methyl-N-(2-piperidin-3-ylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119556963 |
| Molecular Formula | C15H22ClFN2O |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-fluoro-4-methyl-N-(2-piperidin-3-ylethyl)benzamide;hydrochloride |
| SMILES | Cc1ccc(C(=O)NCCC2CCCNC2)cc1F.Cl |
| InChI | InChI=1S/C15H21FN2O.ClH/c1-11-4-5-13(9-14(11)16)15(19)18-8-6-12-3-2-7-17-10-12;/h4-5,9,12,17H,2-3,6-8,10H2,1H3,(H,18,19);1H |
| InChIKey | QKLXVYFBTJZRIN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |