C14H18ClFN2O — CID 107990343
4-chloro-3-fluoro-N-(2-piperidin-3-ylethyl)benzamide (PubChem CID 107990343) has the molecular formula C14H18ClFN2O and a molecular weight of 284.76 g/mol. Its IUPAC name is 4-chloro-3-fluoro-N-(2-piperidin-3-ylethyl)benzamide.
| Compound Name | 4-chloro-3-fluoro-N-(2-piperidin-3-ylethyl)benzamide |
|---|---|
| PubChem CID | 107990343 |
| Molecular Formula | C14H18ClFN2O |
| Molecular Weight | 284.76 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-chloro-3-fluoro-N-(2-piperidin-3-ylethyl)benzamide |
| SMILES | O=C(NCCC1CCCNC1)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C14H18ClFN2O/c15-12-4-3-11(8-13(12)16)14(19)18-7-5-10-2-1-6-17-9-10/h3-4,8,10,17H,1-2,5-7,9H2,(H,18,19) |
| InChIKey | OWDRPRMSKGBYRZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.76 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |