C15H22BrN3O3 — CID 119555101
5-bromo-N-methyl-N-[2-oxo-2-(2-piperidin-3-ylethylamino)ethyl]furan-2-carboxamide (PubChem CID 119555101) has the molecular formula C15H22BrN3O3 and a molecular weight of 372.26 g/mol. Its IUPAC name is 5-bromo-N-methyl-N-[2-oxo-2-(2-piperidin-3-ylethylamino)ethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-methyl-N-[2-oxo-2-(2-piperidin-3-ylethylamino)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 119555101 |
| Molecular Formula | C15H22BrN3O3 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 5-bromo-N-methyl-N-[2-oxo-2-(2-piperidin-3-ylethylamino)ethyl]furan-2-carboxamide |
| SMILES | CN(CC(=O)NCCC1CCCNC1)C(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H22BrN3O3/c1-19(15(21)12-4-5-13(16)22-12)10-14(20)18-8-6-11-3-2-7-17-9-11/h4-5,11,17H,2-3,6-10H2,1H3,(H,18,20) |
| InChIKey | FEDFRJHLGNUZMW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |