C12H17BrN2O4 — CID 51307832
5-bromo-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methylfuran-2-carboxamide (PubChem CID 51307832) has the molecular formula C12H17BrN2O4 and a molecular weight of 333.18 g/mol. Its IUPAC name is 5-bromo-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methylfuran-2-carboxamide.
| Compound Name | 5-bromo-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 51307832 |
| Molecular Formula | C12H17BrN2O4 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 5-bromo-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methylfuran-2-carboxamide |
| SMILES | COCCCNC(=O)CN(C)C(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C12H17BrN2O4/c1-15(8-11(16)14-6-3-7-18-2)12(17)9-4-5-10(13)19-9/h4-5H,3,6-8H2,1-2H3,(H,14,16) |
| InChIKey | VFZWDJFYKZESJQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|