C14H18BrClN2O3 — CID 103841802
3-bromo-4-chloro-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methylbenzamide (PubChem CID 103841802) has the molecular formula C14H18BrClN2O3 and a molecular weight of 377.67 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methylbenzamide.
| Compound Name | 3-bromo-4-chloro-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 103841802 |
| Molecular Formula | C14H18BrClN2O3 |
| Molecular Weight | 377.67 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 3-bromo-4-chloro-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methylbenzamide |
| SMILES | COCCCNC(=O)CN(C)C(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C14H18BrClN2O3/c1-18(9-13(19)17-6-3-7-21-2)14(20)10-4-5-12(16)11(15)8-10/h4-5,8H,3,6-7,9H2,1-2H3,(H,17,19) |
| InChIKey | CQFWCMPEEWQVOD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.67 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|