C13H17BrClNO3 — CID 103841549
3-bromo-4-chloro-N,N-bis(2-methoxyethyl)benzamide (PubChem CID 103841549) has the molecular formula C13H17BrClNO3 and a molecular weight of 350.64 g/mol. Its IUPAC name is 3-bromo-4-chloro-N,N-bis(2-methoxyethyl)benzamide.
| Compound Name | 3-bromo-4-chloro-N,N-bis(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 103841549 |
| Molecular Formula | C13H17BrClNO3 |
| Molecular Weight | 350.64 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 3-bromo-4-chloro-N,N-bis(2-methoxyethyl)benzamide |
| SMILES | COCCN(CCOC)C(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C13H17BrClNO3/c1-18-7-5-16(6-8-19-2)13(17)10-3-4-12(15)11(14)9-10/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | VTNZVMKLMGTWKG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.64 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |