C12H15Cl2NO3 — CID 115772784
3,4-dichloro-N-(2-hydroxyethyl)-N-(2-methoxyethyl)benzamide (PubChem CID 115772784) has the molecular formula C12H15Cl2NO3 and a molecular weight of 292.16 g/mol. Its IUPAC name is 3,4-dichloro-N-(2-hydroxyethyl)-N-(2-methoxyethyl)benzamide.
| Compound Name | 3,4-dichloro-N-(2-hydroxyethyl)-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 115772784 |
| Molecular Formula | C12H15Cl2NO3 |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 3,4-dichloro-N-(2-hydroxyethyl)-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(CCO)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NO3/c1-18-7-5-15(4-6-16)12(17)9-2-3-10(13)11(14)8-9/h2-3,8,16H,4-7H2,1H3 |
| InChIKey | DSCLICCDVPARRJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |