C13H20N2O4 — CID 107074165
4-amino-3-hydroxy-N,N-bis(2-methoxyethyl)benzamide (PubChem CID 107074165) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-amino-3-hydroxy-N,N-bis(2-methoxyethyl)benzamide.
| Compound Name | 4-amino-3-hydroxy-N,N-bis(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 107074165 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 4-amino-3-hydroxy-N,N-bis(2-methoxyethyl)benzamide |
| SMILES | COCCN(CCOC)C(=O)c1ccc(N)c(O)c1 |
| InChI | InChI=1S/C13H20N2O4/c1-18-7-5-15(6-8-19-2)13(17)10-3-4-11(14)12(16)9-10/h3-4,9,16H,5-8,14H2,1-2H3 |
| InChIKey | WCLFMCJLUCNHEY-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|