C14H19NO6 — CID 103957103
methyl 3-[(3,4-dihydroxybenzoyl)-(2-methoxyethyl)amino]propanoate (PubChem CID 103957103) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is methyl 3-[(3,4-dihydroxybenzoyl)-(2-methoxyethyl)amino]propanoate.
| Compound Name | methyl 3-[(3,4-dihydroxybenzoyl)-(2-methoxyethyl)amino]propanoate |
|---|---|
| PubChem CID | 103957103 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | methyl 3-[(3,4-dihydroxybenzoyl)-(2-methoxyethyl)amino]propanoate |
| SMILES | COCCN(CCC(=O)OC)C(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H19NO6/c1-20-8-7-15(6-5-13(18)21-2)14(19)10-3-4-11(16)12(17)9-10/h3-4,9,16-17H,5-8H2,1-2H3 |
| InChIKey | IOLCPAREKJMKPG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|