C13H16Cl2N2O4 — CID 78959056
methyl 3-[(2,6-dichloropyridine-4-carbonyl)-(2-methoxyethyl)amino]propanoate (PubChem CID 78959056) has the molecular formula C13H16Cl2N2O4 and a molecular weight of 335.19 g/mol. Its IUPAC name is methyl 3-[(2,6-dichloropyridine-4-carbonyl)-(2-methoxyethyl)amino]propanoate.
| Compound Name | methyl 3-[(2,6-dichloropyridine-4-carbonyl)-(2-methoxyethyl)amino]propanoate |
|---|---|
| PubChem CID | 78959056 |
| Molecular Formula | C13H16Cl2N2O4 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | methyl 3-[(2,6-dichloropyridine-4-carbonyl)-(2-methoxyethyl)amino]propanoate |
| SMILES | COCCN(CCC(=O)OC)C(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2N2O4/c1-20-6-5-17(4-3-12(18)21-2)13(19)9-7-10(14)16-11(15)8-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | BBTUVDLIWSUPPO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|