C13H17BrClN3O3 — CID 107992488
N-[(3Z)-3-amino-3-hydroxyiminopropyl]-3-bromo-4-chloro-N-(2-methoxyethyl)benzamide (PubChem CID 107992488) has the molecular formula C13H17BrClN3O3 and a molecular weight of 378.65 g/mol. Its IUPAC name is N-[(3Z)-3-amino-3-hydroxyiminopropyl]-3-bromo-4-chloro-N-(2-methoxyethyl)benzamide.
| Compound Name | N-[(3Z)-3-amino-3-hydroxyiminopropyl]-3-bromo-4-chloro-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 107992488 |
| Molecular Formula | C13H17BrClN3O3 |
| Molecular Weight | 378.65 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | N-[(3Z)-3-amino-3-hydroxyiminopropyl]-3-bromo-4-chloro-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(CC/C(N)=N/O)C(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C13H17BrClN3O3/c1-21-7-6-18(5-4-12(16)17-20)13(19)9-2-3-11(15)10(14)8-9/h2-3,8,20H,4-7H2,1H3,(H2,16,17) |
| InChIKey | REROMVNTQGYPII-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.65 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|