C13H18ClN3O4 — CID 106502796
N-[(3Z)-3-amino-3-hydroxyiminopropyl]-2-chloro-5-hydroxy-N-(2-methoxyethyl)benzamide (PubChem CID 106502796) has the molecular formula C13H18ClN3O4 and a molecular weight of 315.76 g/mol. Its IUPAC name is N-[(3Z)-3-amino-3-hydroxyiminopropyl]-2-chloro-5-hydroxy-N-(2-methoxyethyl)benzamide.
| Compound Name | N-[(3Z)-3-amino-3-hydroxyiminopropyl]-2-chloro-5-hydroxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 106502796 |
| Molecular Formula | C13H18ClN3O4 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N-[(3Z)-3-amino-3-hydroxyiminopropyl]-2-chloro-5-hydroxy-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(CC/C(N)=N/O)C(=O)c1cc(O)ccc1Cl |
| InChI | InChI=1S/C13H18ClN3O4/c1-21-7-6-17(5-4-12(15)16-20)13(19)10-8-9(18)2-3-11(10)14/h2-3,8,18,20H,4-7H2,1H3,(H2,15,16) |
| InChIKey | OFXOYXIUGUIMNQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|