C12H21N5O3 — CID 102802159
N-(3-amino-3-hydroxyiminopropyl)-N-(2-methoxyethyl)-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 102802159) has the molecular formula C12H21N5O3 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-(3-amino-3-hydroxyiminopropyl)-N-(2-methoxyethyl)-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | N-(3-amino-3-hydroxyiminopropyl)-N-(2-methoxyethyl)-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 102802159 |
| Molecular Formula | C12H21N5O3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-(3-amino-3-hydroxyiminopropyl)-N-(2-methoxyethyl)-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | COCCN(CCC(N)=NO)C(=O)c1cn(C)nc1C |
| InChI | InChI=1S/C12H21N5O3/c1-9-10(8-16(2)14-9)12(18)17(6-7-20-3)5-4-11(13)15-19/h8,19H,4-7H2,1-3H3,(H2,13,15) |
| InChIKey | HWRBEIIYROUEQV-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|