C14H18ClNO5 — CID 106501591
ethyl 2-[(2-chloro-5-hydroxybenzoyl)-(2-methoxyethyl)amino]acetate (PubChem CID 106501591) has the molecular formula C14H18ClNO5 and a molecular weight of 315.75 g/mol. Its IUPAC name is ethyl 2-[(2-chloro-5-hydroxybenzoyl)-(2-methoxyethyl)amino]acetate.
| Compound Name | ethyl 2-[(2-chloro-5-hydroxybenzoyl)-(2-methoxyethyl)amino]acetate |
|---|---|
| PubChem CID | 106501591 |
| Molecular Formula | C14H18ClNO5 |
| Molecular Weight | 315.75 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | ethyl 2-[(2-chloro-5-hydroxybenzoyl)-(2-methoxyethyl)amino]acetate |
| SMILES | CCOC(=O)CN(CCOC)C(=O)c1cc(O)ccc1Cl |
| InChI | InChI=1S/C14H18ClNO5/c1-3-21-13(18)9-16(6-7-20-2)14(19)11-8-10(17)4-5-12(11)15/h4-5,8,17H,3,6-7,9H2,1-2H3 |
| InChIKey | FASOICZQKHJIKA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.75 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |