C18H27ClN2O6S — CID 55726615
ethyl 2-[[3-(tert-butylsulfamoyl)-4-chlorobenzoyl]-(2-methoxyethyl)amino]acetate (PubChem CID 55726615) has the molecular formula C18H27ClN2O6S and a molecular weight of 434.94 g/mol. Its IUPAC name is ethyl 2-[[3-(tert-butylsulfamoyl)-4-chlorobenzoyl]-(2-methoxyethyl)amino]acetate.
| Compound Name | ethyl 2-[[3-(tert-butylsulfamoyl)-4-chlorobenzoyl]-(2-methoxyethyl)amino]acetate |
|---|---|
| PubChem CID | 55726615 |
| Molecular Formula | C18H27ClN2O6S |
| Molecular Weight | 434.94 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | ethyl 2-[[3-(tert-butylsulfamoyl)-4-chlorobenzoyl]-(2-methoxyethyl)amino]acetate |
| SMILES | CCOC(=O)CN(CCOC)C(=O)c1ccc(Cl)c(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C18H27ClN2O6S/c1-6-27-16(22)12-21(9-10-26-5)17(23)13-7-8-14(19)15(11-13)28(24,25)20-18(2,3)4/h7-8,11,20H,6,9-10,12H2,1-5H3 |
| InChIKey | SDLOEGCHCNTRSG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.94 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |