C17H23ClN2O3S — CID 30878670
3-(tert-butylsulfamoyl)-4-chloro-N,N-bis(prop-2-enyl)benzamide (PubChem CID 30878670) has the molecular formula C17H23ClN2O3S and a molecular weight of 370.90 g/mol. Its IUPAC name is 3-(tert-butylsulfamoyl)-4-chloro-N,N-bis(prop-2-enyl)benzamide.
| Compound Name | 3-(tert-butylsulfamoyl)-4-chloro-N,N-bis(prop-2-enyl)benzamide |
|---|---|
| PubChem CID | 30878670 |
| Molecular Formula | C17H23ClN2O3S |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 3-(tert-butylsulfamoyl)-4-chloro-N,N-bis(prop-2-enyl)benzamide |
| SMILES | C=CCN(CC=C)C(=O)c1ccc(Cl)c(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C17H23ClN2O3S/c1-6-10-20(11-7-2)16(21)13-8-9-14(18)15(12-13)24(22,23)19-17(3,4)5/h6-9,12,19H,1-2,10-11H2,3-5H3 |
| InChIKey | GYYMHIYNFOCRPB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|