C22H26ClN3O3S — CID 55591996
3-(tert-butylsulfamoyl)-4-chloro-N-[1-(4-cyanophenyl)ethyl]-N-ethylbenzamide (PubChem CID 55591996) has the molecular formula C22H26ClN3O3S and a molecular weight of 447.99 g/mol. Its IUPAC name is 3-(tert-butylsulfamoyl)-4-chloro-N-[1-(4-cyanophenyl)ethyl]-N-ethylbenzamide.
| Compound Name | 3-(tert-butylsulfamoyl)-4-chloro-N-[1-(4-cyanophenyl)ethyl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 55591996 |
| Molecular Formula | C22H26ClN3O3S |
| Molecular Weight | 447.99 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 3-(tert-butylsulfamoyl)-4-chloro-N-[1-(4-cyanophenyl)ethyl]-N-ethylbenzamide |
| SMILES | CCN(C(=O)c1ccc(Cl)c(S(=O)(=O)NC(C)(C)C)c1)C(C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C22H26ClN3O3S/c1-6-26(15(2)17-9-7-16(14-24)8-10-17)21(27)18-11-12-19(23)20(13-18)30(28,29)25-22(3,4)5/h7-13,15,25H,6H2,1-5H3 |
| InChIKey | LOAACNWATSAXJM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.99 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |