C17H17Cl4N3O3S — CID 30255802
N-tert-butyl-2-chloro-5-[(2,4,6-trichloroanilino)carbamoyl]benzenesulfonamide (PubChem CID 30255802) has the molecular formula C17H17Cl4N3O3S and a molecular weight of 485.22 g/mol. Its IUPAC name is N-tert-butyl-2-chloro-5-[(2,4,6-trichloroanilino)carbamoyl]benzenesulfonamide.
| Compound Name | N-tert-butyl-2-chloro-5-[(2,4,6-trichloroanilino)carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 30255802 |
| Molecular Formula | C17H17Cl4N3O3S |
| Molecular Weight | 485.22 g/mol |
| Exact Mass | 482.97 |
| IUPAC Name | N-tert-butyl-2-chloro-5-[(2,4,6-trichloroanilino)carbamoyl]benzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cc(C(=O)NNc2c(Cl)cc(Cl)cc2Cl)ccc1Cl |
| InChI | InChI=1S/C17H17Cl4N3O3S/c1-17(2,3)24-28(26,27)14-6-9(4-5-11(14)19)16(25)23-22-15-12(20)7-10(18)8-13(15)21/h4-8,22,24H,1-3H3,(H,23,25) |
| InChIKey | QKJJUKGRMJMBGO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.22 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|