C18H18Cl3N3O2 — CID 35185117
2,2-dimethyl-N-[3-[(2,4,6-trichloroanilino)carbamoyl]phenyl]propanamide (PubChem CID 35185117) has the molecular formula C18H18Cl3N3O2 and a molecular weight of 414.72 g/mol. Its IUPAC name is 2,2-dimethyl-N-[3-[(2,4,6-trichloroanilino)carbamoyl]phenyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[3-[(2,4,6-trichloroanilino)carbamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 35185117 |
| Molecular Formula | C18H18Cl3N3O2 |
| Molecular Weight | 414.72 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 2,2-dimethyl-N-[3-[(2,4,6-trichloroanilino)carbamoyl]phenyl]propanamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(C(=O)NNc2c(Cl)cc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H18Cl3N3O2/c1-18(2,3)17(26)22-12-6-4-5-10(7-12)16(25)24-23-15-13(20)8-11(19)9-14(15)21/h4-9,23H,1-3H3,(H,22,26)(H,24,25) |
| InChIKey | GELXNOZMTZXZAB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.72 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|