C20H23N3O3 — CID 134050295
3-[[3-(2,2-dimethylpropanoylamino)benzoyl]amino]-N-methylbenzamide (PubChem CID 134050295) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-[[3-(2,2-dimethylpropanoylamino)benzoyl]amino]-N-methylbenzamide.
| Compound Name | 3-[[3-(2,2-dimethylpropanoylamino)benzoyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 134050295 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 3-[[3-(2,2-dimethylpropanoylamino)benzoyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)c2cccc(NC(=O)C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C20H23N3O3/c1-20(2,3)19(26)23-16-10-6-8-14(12-16)18(25)22-15-9-5-7-13(11-15)17(24)21-4/h5-12H,1-4H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | MOLORHVYBCRCDG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |