C20H24N2O4S — CID 35781376
3-(2,2-dimethylpropanoylamino)-N-(4-ethylsulfonylphenyl)benzamide (PubChem CID 35781376) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 3-(2,2-dimethylpropanoylamino)-N-(4-ethylsulfonylphenyl)benzamide.
| Compound Name | 3-(2,2-dimethylpropanoylamino)-N-(4-ethylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 35781376 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 3-(2,2-dimethylpropanoylamino)-N-(4-ethylsulfonylphenyl)benzamide |
| SMILES | CCS(=O)(=O)c1ccc(NC(=O)c2cccc(NC(=O)C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C20H24N2O4S/c1-5-27(25,26)17-11-9-15(10-12-17)21-18(23)14-7-6-8-16(13-14)22-19(24)20(2,3)4/h6-13H,5H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | YLJWBDWWKLNLEB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |