C23H29N3O3 — CID 33037592
3-(2,2-dimethylpropanoylamino)-N-[4-(3-methylbutanoylamino)phenyl]benzamide (PubChem CID 33037592) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 3-(2,2-dimethylpropanoylamino)-N-[4-(3-methylbutanoylamino)phenyl]benzamide.
| Compound Name | 3-(2,2-dimethylpropanoylamino)-N-[4-(3-methylbutanoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 33037592 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 3-(2,2-dimethylpropanoylamino)-N-[4-(3-methylbutanoylamino)phenyl]benzamide |
| SMILES | CC(C)CC(=O)Nc1ccc(NC(=O)c2cccc(NC(=O)C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-15(2)13-20(27)24-17-9-11-18(12-10-17)25-21(28)16-7-6-8-19(14-16)26-22(29)23(3,4)5/h6-12,14-15H,13H2,1-5H3,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | VMOZSDYTYQVVNK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |