C19H21N3O3 — CID 17297099
3-[[3-(2,2-dimethylpropanoylamino)benzoyl]amino]benzamide (PubChem CID 17297099) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 3-[[3-(2,2-dimethylpropanoylamino)benzoyl]amino]benzamide.
| Compound Name | 3-[[3-(2,2-dimethylpropanoylamino)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 17297099 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 3-[[3-(2,2-dimethylpropanoylamino)benzoyl]amino]benzamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(C(=O)Nc2cccc(C(N)=O)c2)c1 |
| InChI | InChI=1S/C19H21N3O3/c1-19(2,3)18(25)22-15-9-5-7-13(11-15)17(24)21-14-8-4-6-12(10-14)16(20)23/h4-11H,1-3H3,(H2,20,23)(H,21,24)(H,22,25) |
| InChIKey | LVNWUVMREICJCF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |