C19H20ClN3O2S — CID 17204735
3-chloro-N-[[3-(2,2-dimethylpropanoylamino)phenyl]carbamothioyl]benzamide (PubChem CID 17204735) has the molecular formula C19H20ClN3O2S and a molecular weight of 389.91 g/mol. Its IUPAC name is 3-chloro-N-[[3-(2,2-dimethylpropanoylamino)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-chloro-N-[[3-(2,2-dimethylpropanoylamino)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17204735 |
| Molecular Formula | C19H20ClN3O2S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 3-chloro-N-[[3-(2,2-dimethylpropanoylamino)phenyl]carbamothioyl]benzamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(NC(=S)NC(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C19H20ClN3O2S/c1-19(2,3)17(25)21-14-8-5-9-15(11-14)22-18(26)23-16(24)12-6-4-7-13(20)10-12/h4-11H,1-3H3,(H,21,25)(H2,22,23,24,26) |
| InChIKey | QXEFFPSIXSJHFJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|