C25H23Cl2N3O2S — CID 17232551
N-[[3-[(4-tert-butylbenzoyl)amino]phenyl]carbamothioyl]-3,5-dichlorobenzamide (PubChem CID 17232551) has the molecular formula C25H23Cl2N3O2S and a molecular weight of 500.45 g/mol. Its IUPAC name is N-[[3-[(4-tert-butylbenzoyl)amino]phenyl]carbamothioyl]-3,5-dichlorobenzamide.
| Compound Name | N-[[3-[(4-tert-butylbenzoyl)amino]phenyl]carbamothioyl]-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 17232551 |
| Molecular Formula | C25H23Cl2N3O2S |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | N-[[3-[(4-tert-butylbenzoyl)amino]phenyl]carbamothioyl]-3,5-dichlorobenzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(NC(=S)NC(=O)c3cc(Cl)cc(Cl)c3)c2)cc1 |
| InChI | InChI=1S/C25H23Cl2N3O2S/c1-25(2,3)17-9-7-15(8-10-17)22(31)28-20-5-4-6-21(14-20)29-24(33)30-23(32)16-11-18(26)13-19(27)12-16/h4-14H,1-3H3,(H,28,31)(H2,29,30,32,33) |
| InChIKey | RYESWXWMKDVCET-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|