C23H20ClN3O2S — CID 17223177
3-chloro-N-[[3-(3-phenylpropanoylamino)phenyl]carbamothioyl]benzamide (PubChem CID 17223177) has the molecular formula C23H20ClN3O2S and a molecular weight of 437.95 g/mol. Its IUPAC name is 3-chloro-N-[[3-(3-phenylpropanoylamino)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-chloro-N-[[3-(3-phenylpropanoylamino)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17223177 |
| Molecular Formula | C23H20ClN3O2S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 3-chloro-N-[[3-(3-phenylpropanoylamino)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(CCc1ccccc1)Nc1cccc(NC(=S)NC(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C23H20ClN3O2S/c24-18-9-4-8-17(14-18)22(29)27-23(30)26-20-11-5-10-19(15-20)25-21(28)13-12-16-6-2-1-3-7-16/h1-11,14-15H,12-13H2,(H,25,28)(H2,26,27,29,30) |
| InChIKey | PLWQAUNONSBXGO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|