C27H29N3O4S — CID 17223231
4-(2-ethoxyethoxy)-N-[[3-(3-phenylpropanoylamino)phenyl]carbamothioyl]benzamide (PubChem CID 17223231) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is 4-(2-ethoxyethoxy)-N-[[3-(3-phenylpropanoylamino)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-(2-ethoxyethoxy)-N-[[3-(3-phenylpropanoylamino)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17223231 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 4-(2-ethoxyethoxy)-N-[[3-(3-phenylpropanoylamino)phenyl]carbamothioyl]benzamide |
| SMILES | CCOCCOc1ccc(C(=O)NC(=S)Nc2cccc(NC(=O)CCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H29N3O4S/c1-2-33-17-18-34-24-14-12-21(13-15-24)26(32)30-27(35)29-23-10-6-9-22(19-23)28-25(31)16-11-20-7-4-3-5-8-20/h3-10,12-15,19H,2,11,16-18H2,1H3,(H,28,31)(H2,29,30,32,35) |
| InChIKey | YJKBYBQDBLESMB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|