C18H19BrN2O3S — CID 17252493
N-[(3-bromophenyl)carbamothioyl]-4-(2-ethoxyethoxy)benzamide (PubChem CID 17252493) has the molecular formula C18H19BrN2O3S and a molecular weight of 423.33 g/mol. Its IUPAC name is N-[(3-bromophenyl)carbamothioyl]-4-(2-ethoxyethoxy)benzamide.
| Compound Name | N-[(3-bromophenyl)carbamothioyl]-4-(2-ethoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17252493 |
| Molecular Formula | C18H19BrN2O3S |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | N-[(3-bromophenyl)carbamothioyl]-4-(2-ethoxyethoxy)benzamide |
| SMILES | CCOCCOc1ccc(C(=O)NC(=S)Nc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C18H19BrN2O3S/c1-2-23-10-11-24-16-8-6-13(7-9-16)17(22)21-18(25)20-15-5-3-4-14(19)12-15/h3-9,12H,2,10-11H2,1H3,(H2,20,21,22,25) |
| InChIKey | DLIPAIKFHKSJDV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|