C25H26N2O4S — CID 17097060
4-(2-phenoxyethoxy)-N-[(3-propoxyphenyl)carbamothioyl]benzamide (PubChem CID 17097060) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is 4-(2-phenoxyethoxy)-N-[(3-propoxyphenyl)carbamothioyl]benzamide.
| Compound Name | 4-(2-phenoxyethoxy)-N-[(3-propoxyphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17097060 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 4-(2-phenoxyethoxy)-N-[(3-propoxyphenyl)carbamothioyl]benzamide |
| SMILES | CCCOc1cccc(NC(=S)NC(=O)c2ccc(OCCOc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H26N2O4S/c1-2-15-29-23-10-6-7-20(18-23)26-25(32)27-24(28)19-11-13-22(14-12-19)31-17-16-30-21-8-4-3-5-9-21/h3-14,18H,2,15-17H2,1H3,(H2,26,27,28,32) |
| InChIKey | DEBVWOQWPBEAGN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|