C22H28N2O3S — CID 17097411
N-[[3-(3-methylbutoxy)phenyl]carbamothioyl]-4-propoxybenzamide (PubChem CID 17097411) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is N-[[3-(3-methylbutoxy)phenyl]carbamothioyl]-4-propoxybenzamide.
| Compound Name | N-[[3-(3-methylbutoxy)phenyl]carbamothioyl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 17097411 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-[[3-(3-methylbutoxy)phenyl]carbamothioyl]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NC(=S)Nc2cccc(OCCC(C)C)c2)cc1 |
| InChI | InChI=1S/C22H28N2O3S/c1-4-13-26-19-10-8-17(9-11-19)21(25)24-22(28)23-18-6-5-7-20(15-18)27-14-12-16(2)3/h5-11,15-16H,4,12-14H2,1-3H3,(H2,23,24,25,28) |
| InChIKey | GEAIDGFAQXOCHS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|