C24H31N3O3S — CID 17204752
N-[[3-(2,2-dimethylpropanoylamino)phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide (PubChem CID 17204752) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is N-[[3-(2,2-dimethylpropanoylamino)phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide.
| Compound Name | N-[[3-(2,2-dimethylpropanoylamino)phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17204752 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-[[3-(2,2-dimethylpropanoylamino)phenyl]carbamothioyl]-4-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)NC(=S)Nc2cccc(NC(=O)C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C24H31N3O3S/c1-16(2)13-14-30-20-11-9-17(10-12-20)21(28)27-23(31)26-19-8-6-7-18(15-19)25-22(29)24(3,4)5/h6-12,15-16H,13-14H2,1-5H3,(H,25,29)(H2,26,27,28,31) |
| InChIKey | FGJPPQKDWOVHEM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|