C23H20N4O4S — CID 17223130
3-nitro-N-[[3-(3-phenylpropanoylamino)phenyl]carbamothioyl]benzamide (PubChem CID 17223130) has the molecular formula C23H20N4O4S and a molecular weight of 448.50 g/mol. Its IUPAC name is 3-nitro-N-[[3-(3-phenylpropanoylamino)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-nitro-N-[[3-(3-phenylpropanoylamino)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17223130 |
| Molecular Formula | C23H20N4O4S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 3-nitro-N-[[3-(3-phenylpropanoylamino)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(CCc1ccccc1)Nc1cccc(NC(=S)NC(=O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C23H20N4O4S/c28-21(13-12-16-6-2-1-3-7-16)24-18-9-5-10-19(15-18)25-23(32)26-22(29)17-8-4-11-20(14-17)27(30)31/h1-11,14-15H,12-13H2,(H,24,28)(H2,25,26,29,32) |
| InChIKey | XLGWVCLHJRZGTI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|