C16H16ClN3OS — CID 9480196
1-(3-chlorophenyl)-3-(3-phenylpropanoylamino)thiourea (PubChem CID 9480196) has the molecular formula C16H16ClN3OS and a molecular weight of 333.84 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(3-phenylpropanoylamino)thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-(3-phenylpropanoylamino)thiourea |
|---|---|
| PubChem CID | 9480196 |
| Molecular Formula | C16H16ClN3OS |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(3-phenylpropanoylamino)thiourea |
| SMILES | O=C(CCc1ccccc1)NNC(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H16ClN3OS/c17-13-7-4-8-14(11-13)18-16(22)20-19-15(21)10-9-12-5-2-1-3-6-12/h1-8,11H,9-10H2,(H,19,21)(H2,18,20,22) |
| InChIKey | DTFAGJGJSQABCK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|