C20H24ClN3OS — CID 9376702
1-[3-(4-tert-butylphenyl)propanoylamino]-3-(3-chlorophenyl)thiourea (PubChem CID 9376702) has the molecular formula C20H24ClN3OS and a molecular weight of 389.95 g/mol. Its IUPAC name is 1-[3-(4-tert-butylphenyl)propanoylamino]-3-(3-chlorophenyl)thiourea.
| Compound Name | 1-[3-(4-tert-butylphenyl)propanoylamino]-3-(3-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 9376702 |
| Molecular Formula | C20H24ClN3OS |
| Molecular Weight | 389.95 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 1-[3-(4-tert-butylphenyl)propanoylamino]-3-(3-chlorophenyl)thiourea |
| SMILES | CC(C)(C)c1ccc(CCC(=O)NNC(=S)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H24ClN3OS/c1-20(2,3)15-10-7-14(8-11-15)9-12-18(25)23-24-19(26)22-17-6-4-5-16(21)13-17/h4-8,10-11,13H,9,12H2,1-3H3,(H,23,25)(H2,22,24,26) |
| InChIKey | MEUTZLKPHKIJLT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.95 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|