C16H15ClFN3OS — CID 9428355
1-(3-chlorophenyl)-3-[3-(2-fluorophenyl)propanoylamino]thiourea (PubChem CID 9428355) has the molecular formula C16H15ClFN3OS and a molecular weight of 351.83 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[3-(2-fluorophenyl)propanoylamino]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[3-(2-fluorophenyl)propanoylamino]thiourea |
|---|---|
| PubChem CID | 9428355 |
| Molecular Formula | C16H15ClFN3OS |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[3-(2-fluorophenyl)propanoylamino]thiourea |
| SMILES | O=C(CCc1ccccc1F)NNC(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H15ClFN3OS/c17-12-5-3-6-13(10-12)19-16(23)21-20-15(22)9-8-11-4-1-2-7-14(11)18/h1-7,10H,8-9H2,(H,20,22)(H2,19,21,23) |
| InChIKey | XUIHWZUJMDKQFB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|