C19H20ClN3O2S — CID 9376944
1-(3-chlorophenyl)-3-[[4-(3,4-dimethylphenyl)-4-oxobutanoyl]amino]thiourea (PubChem CID 9376944) has the molecular formula C19H20ClN3O2S and a molecular weight of 389.91 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[[4-(3,4-dimethylphenyl)-4-oxobutanoyl]amino]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[[4-(3,4-dimethylphenyl)-4-oxobutanoyl]amino]thiourea |
|---|---|
| PubChem CID | 9376944 |
| Molecular Formula | C19H20ClN3O2S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[[4-(3,4-dimethylphenyl)-4-oxobutanoyl]amino]thiourea |
| SMILES | Cc1ccc(C(=O)CCC(=O)NNC(=S)Nc2cccc(Cl)c2)cc1C |
| InChI | InChI=1S/C19H20ClN3O2S/c1-12-6-7-14(10-13(12)2)17(24)8-9-18(25)22-23-19(26)21-16-5-3-4-15(20)11-16/h3-7,10-11H,8-9H2,1-2H3,(H,22,25)(H2,21,23,26) |
| InChIKey | JYYCWIBKDDQOQD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|