C17H22ClN5O3S — CID 9376723
1-[[4-(4-acetylpiperazin-1-yl)-4-oxobutanoyl]amino]-3-(3-chlorophenyl)thiourea (PubChem CID 9376723) has the molecular formula C17H22ClN5O3S and a molecular weight of 411.92 g/mol. Its IUPAC name is 1-[[4-(4-acetylpiperazin-1-yl)-4-oxobutanoyl]amino]-3-(3-chlorophenyl)thiourea.
| Compound Name | 1-[[4-(4-acetylpiperazin-1-yl)-4-oxobutanoyl]amino]-3-(3-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 9376723 |
| Molecular Formula | C17H22ClN5O3S |
| Molecular Weight | 411.92 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 1-[[4-(4-acetylpiperazin-1-yl)-4-oxobutanoyl]amino]-3-(3-chlorophenyl)thiourea |
| SMILES | CC(=O)N1CCN(C(=O)CCC(=O)NNC(=S)Nc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H22ClN5O3S/c1-12(24)22-7-9-23(10-8-22)16(26)6-5-15(25)20-21-17(27)19-14-4-2-3-13(18)11-14/h2-4,11H,5-10H2,1H3,(H,20,25)(H2,19,21,27) |
| InChIKey | WRLXPYCXOAJCNU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.92 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|