C12H13ClN4O2S2 — CID 9088038
1-(3-chlorophenyl)-3-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]thiourea (PubChem CID 9088038) has the molecular formula C12H13ClN4O2S2 and a molecular weight of 344.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 9088038 |
| Molecular Formula | C12H13ClN4O2S2 |
| Molecular Weight | 344.85 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]thiourea |
| SMILES | O=C(CN1CCSC1=O)NNC(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H13ClN4O2S2/c13-8-2-1-3-9(6-8)14-11(20)16-15-10(18)7-17-4-5-21-12(17)19/h1-3,6H,4-5,7H2,(H,15,18)(H2,14,16,20) |
| InChIKey | QMXANUMUFIHOTO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.85 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|