C19H19ClN4O2S — CID 9376927
1-(3-chlorophenyl)-3-[[2-[4-(2-oxopyrrolidin-1-yl)phenyl]acetyl]amino]thiourea (PubChem CID 9376927) has the molecular formula C19H19ClN4O2S and a molecular weight of 402.91 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[[2-[4-(2-oxopyrrolidin-1-yl)phenyl]acetyl]amino]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[[2-[4-(2-oxopyrrolidin-1-yl)phenyl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 9376927 |
| Molecular Formula | C19H19ClN4O2S |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[[2-[4-(2-oxopyrrolidin-1-yl)phenyl]acetyl]amino]thiourea |
| SMILES | O=C(Cc1ccc(N2CCCC2=O)cc1)NNC(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H19ClN4O2S/c20-14-3-1-4-15(12-14)21-19(27)23-22-17(25)11-13-6-8-16(9-7-13)24-10-2-5-18(24)26/h1,3-4,6-9,12H,2,5,10-11H2,(H,22,25)(H2,21,23,27) |
| InChIKey | KNHPSRJUTNGQPE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|