C13H15N3O3S — CID 18146222
N-methyl-3-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]benzamide (PubChem CID 18146222) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is N-methyl-3-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]benzamide.
| Compound Name | N-methyl-3-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 18146222 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-methyl-3-[[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]amino]benzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)CN2CCSC2=O)c1 |
| InChI | InChI=1S/C13H15N3O3S/c1-14-12(18)9-3-2-4-10(7-9)15-11(17)8-16-5-6-20-13(16)19/h2-4,7H,5-6,8H2,1H3,(H,14,18)(H,15,17) |
| InChIKey | YDYQKKMMYGEIAM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|