C12H13ClN2O2S — CID 17487300
N-(3-chlorophenyl)-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide (PubChem CID 17487300) has the molecular formula C12H13ClN2O2S and a molecular weight of 284.77 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide.
| Compound Name | N-(3-chlorophenyl)-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 17487300 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | N-(3-chlorophenyl)-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
| SMILES | O=C(CCN1CCSC1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H13ClN2O2S/c13-9-2-1-3-10(8-9)14-11(16)4-5-15-6-7-18-12(15)17/h1-3,8H,4-7H2,(H,14,16) |
| InChIKey | ILZQYOYUQZDMCT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|