C14H19N3O4S2 — CID 18093524
N-[4-(dimethylsulfamoyl)phenyl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide (PubChem CID 18093524) has the molecular formula C14H19N3O4S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is N-[4-(dimethylsulfamoyl)phenyl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide.
| Compound Name | N-[4-(dimethylsulfamoyl)phenyl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 18093524 |
| Molecular Formula | C14H19N3O4S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-[4-(dimethylsulfamoyl)phenyl]-3-(2-oxo-1,3-thiazolidin-3-yl)propanamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)CCN2CCSC2=O)cc1 |
| InChI | InChI=1S/C14H19N3O4S2/c1-16(2)23(20,21)12-5-3-11(4-6-12)15-13(18)7-8-17-9-10-22-14(17)19/h3-6H,7-10H2,1-2H3,(H,15,18) |
| InChIKey | FCBSAORIAJUKJF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|